C19H26F3N5S — CID 111687688
1-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111687688) has the molecular formula C19H26F3N5S and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111687688 |
| Molecular Formula | C19H26F3N5S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN(C)Cc1cccc(CN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C19H26F3N5S/c1-4-27(3)12-15-7-5-6-14(10-15)11-25-18(23-2)24-9-8-17-26-16(13-28-17)19(20,21)22/h5-7,10,13H,4,8-9,11-12H2,1-3H3,(H2,23,24,25) |
| InChIKey | AWIXACSHQIHDMS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|