C20H24F3N5OS — CID 111689890
2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689890) has the molecular formula C20H24F3N5OS and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689890 |
| Molecular Formula | C20H24F3N5OS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C20H24F3N5OS/c1-24-19(25-8-7-17-27-16(13-30-17)20(21,22)23)26-11-14-4-2-5-15(10-14)12-28-9-3-6-18(28)29/h2,4-5,10,13H,3,6-9,11-12H2,1H3,(H2,24,25,26) |
| InChIKey | OMZYSEVBRIDNBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|