C19H25F3IN5S — CID 111689319
2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689319) has the molecular formula C19H25F3IN5S and a molecular weight of 539.41 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689319 |
| Molecular Formula | C19H25F3IN5S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1ccc2c(c1)CCCN2C.I |
| InChI | InChI=1S/C19H24F3N5S.HI/c1-23-18(24-8-7-17-26-16(12-28-17)19(20,21)22)25-11-13-5-6-15-14(10-13)4-3-9-27(15)2;/h5-6,10,12H,3-4,7-9,11H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | SECHZWUNFADOOE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|