C22H31IN4O — CID 111170874
1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 111170874) has the molecular formula C22H31IN4O and a molecular weight of 494.42 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111170874 |
| Molecular Formula | C22H31IN4O |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)cc1)NCc1ccc2c(c1)CCCN2C.I |
| InChI | InChI=1S/C22H30N4O.HI/c1-23-22(24-13-12-17-6-9-20(27-3)10-7-17)25-16-18-8-11-21-19(15-18)5-4-14-26(21)2;/h6-11,15H,4-5,12-14,16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | FFVGWFSLQIDILD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|