C18H30N4 — CID 111001097
2-methyl-1-(3-methylbutan-2-yl)-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine (PubChem CID 111001097) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 2-methyl-1-(3-methylbutan-2-yl)-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-methylbutan-2-yl)-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111001097 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 2-methyl-1-(3-methylbutan-2-yl)-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc2c(c1)CCCN2C)NC(C)C(C)C |
| InChI | InChI=1S/C18H30N4/c1-13(2)14(3)21-18(19-4)20-12-15-8-9-17-16(11-15)7-6-10-22(17)5/h8-9,11,13-14H,6-7,10,12H2,1-5H3,(H2,19,20,21) |
| InChIKey | CCQODBSFHGDJFK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|