C25H36IN5O — CID 111374812
2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111374812) has the molecular formula C25H36IN5O and a molecular weight of 549.50 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111374812 |
| Molecular Formula | C25H36IN5O |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 2-methyl-1-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-3-[[2-(morpholin-4-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)CCCN2C)NCc1ccccc1CN1CCOCC1.I |
| InChI | InChI=1S/C25H35N5O.HI/c1-26-25(27-17-20-9-10-24-21(16-20)8-5-11-29(24)2)28-18-22-6-3-4-7-23(22)19-30-12-14-31-15-13-30;/h3-4,6-7,9-10,16H,5,8,11-15,17-19H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | JSZDNQRNBCIPDW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|