C14H23IN4 — CID 110916628
1,2-dimethyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 110916628) has the molecular formula C14H23IN4 and a molecular weight of 374.27 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110916628 |
| Molecular Formula | C14H23IN4 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccc2c(c1)CCCN2C.I |
| InChI | InChI=1S/C14H22N4.HI/c1-15-14(16-2)17-10-11-6-7-13-12(9-11)5-4-8-18(13)3;/h6-7,9H,4-5,8,10H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | QLYDAOUUDVMIHP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|