C19H25F3N6S — CID 111687522
2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111687522) has the molecular formula C19H25F3N6S and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111687522 |
| Molecular Formula | C19H25F3N6S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C19H25F3N6S/c1-23-18(25-8-6-17-27-15(13-29-17)19(20,21)22)26-12-14-5-7-24-16(11-14)28-9-3-2-4-10-28/h5,7,11,13H,2-4,6,8-10,12H2,1H3,(H2,23,25,26) |
| InChIKey | OBGQIXOGQLJPMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|