C17H26F3N5 — CID 109471543
1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471543) has the molecular formula C17H26F3N5 and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471543 |
| Molecular Formula | C17H26F3N5 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccnc(N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H26F3N5/c1-21-16(23-9-7-17(18,19)20)24-13-14-6-8-22-15(12-14)25-10-4-2-3-5-11-25/h6,8,12H,2-5,7,9-11,13H2,1H3,(H2,21,23,24) |
| InChIKey | KTXHBOOIGQFPCY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|