C22H29F3IN5 — CID 111296006
2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111296006) has the molecular formula C22H29F3IN5 and a molecular weight of 547.41 g/mol. Its IUPAC name is 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111296006 |
| Molecular Formula | C22H29F3IN5 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-methyl-1-[(2-piperidin-1-yl-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(C(F)(F)F)cc1)NCc1ccnc(N2CCCCC2)c1.I |
| InChI | InChI=1S/C22H28F3N5.HI/c1-26-21(28-12-9-17-5-7-19(8-6-17)22(23,24)25)29-16-18-10-11-27-20(15-18)30-13-3-2-4-14-30;/h5-8,10-11,15H,2-4,9,12-14,16H2,1H3,(H2,26,28,29);1H |
| InChIKey | DQQMWRURKJRNKS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|