C16H16F3N7S — CID 111616750
2-methyl-1-[(2-pyrazol-1-yl-4-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616750) has the molecular formula C16H16F3N7S and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-methyl-1-[(2-pyrazol-1-yl-4-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-pyrazol-1-yl-4-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616750 |
| Molecular Formula | C16H16F3N7S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-methyl-1-[(2-pyrazol-1-yl-4-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccnc(-n2cccn2)c1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H16F3N7S/c1-20-15(23-9-14-25-12(10-27-14)16(17,18)19)22-8-11-3-5-21-13(7-11)26-6-2-4-24-26/h2-7,10H,8-9H2,1H3,(H2,20,22,23) |
| InChIKey | GRDLMPGWDUEKOA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|