C12H16F3IN6S — CID 111617127
2-methyl-1-(2-pyrazol-1-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617127) has the molecular formula C12H16F3IN6S and a molecular weight of 460.27 g/mol. Its IUPAC name is 2-methyl-1-(2-pyrazol-1-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-pyrazol-1-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617127 |
| Molecular Formula | C12H16F3IN6S |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 2-methyl-1-(2-pyrazol-1-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCn1cccn1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C12H15F3N6S.HI/c1-16-11(17-4-6-21-5-2-3-19-21)18-7-10-20-9(8-22-10)12(13,14)15;/h2-3,5,8H,4,6-7H2,1H3,(H2,16,17,18);1H |
| InChIKey | WDGBVEJYMMENQG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|