C13H23F3IN5O2S2 — CID 111985832
1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111985832) has the molecular formula C13H23F3IN5O2S2 and a molecular weight of 529.39 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985832 |
| Molecular Formula | C13H23F3IN5O2S2 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C13H22F3N5O2S2.HI/c1-4-21(5-2)25(22,23)7-6-18-12(17-3)19-8-11-20-10(9-24-11)13(14,15)16;/h9H,4-8H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | VCFPOOQISGPXAL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|