C16H19F3N4O2S2 — CID 111616962
1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616962) has the molecular formula C16H19F3N4O2S2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616962 |
| Molecular Formula | C16H19F3N4O2S2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCCCS(=O)(=O)c1ccccc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H19F3N4O2S2/c1-20-15(22-10-14-23-13(11-26-14)16(17,18)19)21-8-5-9-27(24,25)12-6-3-2-4-7-12/h2-4,6-7,11H,5,8-10H2,1H3,(H2,20,21,22) |
| InChIKey | ILOCVFQANJTSGF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|