C12H20F3IN4O2S2 — CID 111687959
2-methyl-1-(3-methylsulfonylpropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687959) has the molecular formula C12H20F3IN4O2S2 and a molecular weight of 500.35 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfonylpropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-methylsulfonylpropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687959 |
| Molecular Formula | C12H20F3IN4O2S2 |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | 2-methyl-1-(3-methylsulfonylpropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C12H19F3N4O2S2.HI/c1-16-11(17-5-3-7-23(2,20)21)18-6-4-10-19-9(8-22-10)12(13,14)15;/h8H,3-7H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | SUGMIBXPJGOBMK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|