C14H19F3N6S — CID 111687990
1-(3-imidazol-1-ylpropyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111687990) has the molecular formula C14H19F3N6S and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111687990 |
| Molecular Formula | C14H19F3N6S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCCn1ccnc1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C14H19F3N6S/c1-18-13(20-4-2-7-23-8-6-19-10-23)21-5-3-12-22-11(9-24-12)14(15,16)17/h6,8-10H,2-5,7H2,1H3,(H2,18,20,21) |
| InChIKey | YHOKNFDGBGCTPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|