C14H22F3N5OS — CID 111688602
2-methyl-N-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111688602) has the molecular formula C14H22F3N5OS and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111688602 |
| Molecular Formula | C14H22F3N5OS |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C14H22F3N5OS/c1-9(2)12(23)19-6-7-21-13(18-3)20-5-4-11-22-10(8-24-11)14(15,16)17/h8-9H,4-7H2,1-3H3,(H,19,23)(H2,18,20,21) |
| InChIKey | SRXGXAASMJBRJV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|