C16H25F3N4S — CID 111689010
1-(2-cyclohexylethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689010) has the molecular formula C16H25F3N4S and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-(2-cyclohexylethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689010 |
| Molecular Formula | C16H25F3N4S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-(2-cyclohexylethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCCC1CCCCC1 |
| InChI | InChI=1S/C16H25F3N4S/c1-20-15(21-9-7-12-5-3-2-4-6-12)22-10-8-14-23-13(11-24-14)16(17,18)19/h11-12H,2-10H2,1H3,(H2,20,21,22) |
| InChIKey | VFXMLXBGTGFTPU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|