C14H24F3IN4OS — CID 111687515
1-(2-butoxyethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687515) has the molecular formula C14H24F3IN4OS and a molecular weight of 480.34 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2-butoxyethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687515 |
| Molecular Formula | C14H24F3IN4OS |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-(2-butoxyethyl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCCCOCCN/C(=N\C)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C14H23F3N4OS.HI/c1-3-4-8-22-9-7-20-13(18-2)19-6-5-12-21-11(10-23-12)14(15,16)17;/h10H,3-9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | NVIDWBCYBHQZKI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|