C17H21F4IN4OS — CID 111689315
1-[3-(4-fluorophenoxy)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111689315) has the molecular formula C17H21F4IN4OS and a molecular weight of 532.35 g/mol. Its IUPAC name is 1-[3-(4-fluorophenoxy)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-fluorophenoxy)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111689315 |
| Molecular Formula | C17H21F4IN4OS |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 1-[3-(4-fluorophenoxy)propyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOc1ccc(F)cc1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H20F4N4OS.HI/c1-22-16(23-8-2-10-26-13-5-3-12(18)4-6-13)24-9-7-15-25-14(11-27-15)17(19,20)21;/h3-6,11H,2,7-10H2,1H3,(H2,22,23,24);1H |
| InChIKey | JNOZLLQVDKOEQM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|