C16H19ClF3IN4OS — CID 111688949
1-[2-(4-chlorophenoxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688949) has the molecular formula C16H19ClF3IN4OS and a molecular weight of 534.77 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688949 |
| Molecular Formula | C16H19ClF3IN4OS |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(Cl)cc1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H18ClF3N4OS.HI/c1-21-15(23-8-9-25-12-4-2-11(17)3-5-12)22-7-6-14-24-13(10-26-14)16(18,19)20;/h2-5,10H,6-9H2,1H3,(H2,21,22,23);1H |
| InChIKey | IIPSSDWDAVZWSN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|