C18H23F3IN5O2S — CID 111689659
2-[4-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 111689659) has the molecular formula C18H23F3IN5O2S and a molecular weight of 557.38 g/mol. Its IUPAC name is 2-[4-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[4-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111689659 |
| Molecular Formula | C18H23F3IN5O2S |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 2-[4-[2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OCC(N)=O)cc1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H22F3N5O2S.HI/c1-23-17(25-9-7-16-26-14(11-29-16)18(19,20)21)24-8-6-12-2-4-13(5-3-12)28-10-15(22)27;/h2-5,11H,6-10H2,1H3,(H2,22,27)(H2,23,24,25);1H |
| InChIKey | IFXHBXRVWLLYJO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|