C17H20F3IN4O3S — CID 111687537
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687537) has the molecular formula C17H20F3IN4O3S and a molecular weight of 544.34 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687537 |
| Molecular Formula | C17H20F3IN4O3S |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)OCO2)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C17H19F3N4O3S.HI/c1-21-16(22-5-4-15-24-14(9-28-15)17(18,19)20)23-6-7-25-11-2-3-12-13(8-11)27-10-26-12;/h2-3,8-9H,4-7,10H2,1H3,(H2,21,22,23);1H |
| InChIKey | OZLGUZKBPBPLDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|