C14H19F3IN3O3 — CID 109474078
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474078) has the molecular formula C14H19F3IN3O3 and a molecular weight of 461.22 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474078 |
| Molecular Formula | C14H19F3IN3O3 |
| Molecular Weight | 461.22 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)OCO2)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H18F3N3O3.HI/c1-18-13(19-5-4-14(15,16)17)20-6-7-21-10-2-3-11-12(8-10)23-9-22-11;/h2-3,8H,4-7,9H2,1H3,(H2,18,19,20);1H |
| InChIKey | SOQHVOMCRPMOIU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|