C18H29IN4O5 — CID 111883912
tert-butyl N-[2-[[N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883912) has the molecular formula C18H29IN4O5 and a molecular weight of 508.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883912 |
| Molecular Formula | C18H29IN4O5 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | tert-butyl N-[2-[[N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCCOc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C18H28N4O5.HI/c1-18(2,3)27-17(23)22-8-7-20-16(19-4)21-9-10-24-13-5-6-14-15(11-13)26-12-25-14;/h5-6,11H,7-10,12H2,1-4H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | SOFVWFPEXIMKLP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|