C17H25IN4O4 — CID 119115774
4-acetyl-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119115774) has the molecular formula C17H25IN4O4 and a molecular weight of 476.32 g/mol. Its IUPAC name is 4-acetyl-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119115774 |
| Molecular Formula | C17H25IN4O4 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 4-acetyl-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc2c(c1)OCO2)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C17H24N4O4.HI/c1-13(22)20-6-8-21(9-7-20)17(18-2)19-5-10-23-14-3-4-15-16(11-14)25-12-24-15;/h3-4,11H,5-10,12H2,1-2H3,(H,18,19);1H |
| InChIKey | QAFOTVQVTMQMPR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|