C12H17ClN2O4 — CID 119735550
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119735550) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119735550 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NCCOc1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C12H16N2O4.ClH/c1-13-7-12(15)14-4-5-16-9-2-3-10-11(6-9)18-8-17-10;/h2-3,6,13H,4-5,7-8H2,1H3,(H,14,15);1H |
| InChIKey | PYOCBUAPBUHSPQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|