C18H17IN2O5 — CID 55847087
N-[2-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-2-oxoethyl]-2-iodobenzamide (PubChem CID 55847087) has the molecular formula C18H17IN2O5 and a molecular weight of 468.25 g/mol. Its IUPAC name is N-[2-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 55847087 |
| Molecular Formula | C18H17IN2O5 |
| Molecular Weight | 468.25 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-[2-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-2-oxoethyl]-2-iodobenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17IN2O5/c19-14-4-2-1-3-13(14)18(23)21-10-17(22)20-7-8-24-12-5-6-15-16(9-12)26-11-25-15/h1-6,9H,7-8,10-11H2,(H,20,22)(H,21,23) |
| InChIKey | PJOCQRAGLNKEDK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|