C18H19NO5 — CID 30350403
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-ethoxybenzamide (PubChem CID 30350403) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-ethoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 30350403 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19NO5/c1-2-21-15-6-4-3-5-14(15)18(20)19-9-10-22-13-7-8-16-17(11-13)24-12-23-16/h3-8,11H,2,9-10,12H2,1H3,(H,19,20) |
| InChIKey | MNVQNJSFNSWPEF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|