C20H25N3O4 — CID 55739563
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)-2-phenylethyl]urea (PubChem CID 55739563) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)-2-phenylethyl]urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 55739563 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)-2-phenylethyl]urea |
| SMILES | CN(C)C(CNC(=O)NCCOc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O4/c1-23(2)17(15-6-4-3-5-7-15)13-22-20(24)21-10-11-25-16-8-9-18-19(12-16)27-14-26-18/h3-9,12,17H,10-11,13-14H2,1-2H3,(H2,21,22,24) |
| InChIKey | NFVFZWUSEBUDIK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|