C18H21ClN2O4 — CID 119296028
(2S)-2-amino-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-phenylpropanamide;hydrochloride (PubChem CID 119296028) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-phenylpropanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119296028 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S)-2-amino-N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-phenylpropanamide;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O4.ClH/c19-15(10-13-4-2-1-3-5-13)18(21)20-8-9-22-14-6-7-16-17(11-14)24-12-23-16;/h1-7,11,15H,8-10,12,19H2,(H,20,21);1H/t15-;/m0./s1 |
| InChIKey | SZFROYKPPLIMKN-RSAXXLAASA-N |
| XLogP | 1.90 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|