C12H15NO5 — CID 113101754
ethyl N-[2-(1,3-benzodioxol-5-yloxy)ethyl]carbamate (PubChem CID 113101754) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is ethyl N-[2-(1,3-benzodioxol-5-yloxy)ethyl]carbamate.
| Compound Name | ethyl N-[2-(1,3-benzodioxol-5-yloxy)ethyl]carbamate |
|---|---|
| PubChem CID | 113101754 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | ethyl N-[2-(1,3-benzodioxol-5-yloxy)ethyl]carbamate |
| SMILES | CCOC(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO5/c1-2-15-12(14)13-5-6-16-9-3-4-10-11(7-9)18-8-17-10/h3-4,7H,2,5-6,8H2,1H3,(H,13,14) |
| InChIKey | UILKBZKFSRSIRR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|