C15H22N2O4 — CID 112975151
3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-butyl-1-methylurea (PubChem CID 112975151) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-butyl-1-methylurea.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-butyl-1-methylurea |
|---|---|
| PubChem CID | 112975151 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-butyl-1-methylurea |
| SMILES | CCCCN(C)C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O4/c1-3-4-8-17(2)15(18)16-7-9-19-12-5-6-13-14(10-12)21-11-20-13/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,16,18) |
| InChIKey | YPUQSFHILQHKBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|