C14H18N2O5 — CID 9137733
2-(1,3-benzodioxol-5-yloxy)-N-(butylcarbamoyl)acetamide (PubChem CID 9137733) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-(butylcarbamoyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-(butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9137733 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-(butylcarbamoyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O5/c1-2-3-6-15-14(18)16-13(17)8-19-10-4-5-11-12(7-10)21-9-20-11/h4-5,7H,2-3,6,8-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | CZTIRPDEJLVUCS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|