C12H17NO5 — CID 171659175
2-(1,3-benzodioxol-5-yloxy)-N-(ethoxymethyl)acetamide;molecular hydrogen (PubChem CID 171659175) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-(ethoxymethyl)acetamide;molecular hydrogen.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-(ethoxymethyl)acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 171659175 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-(ethoxymethyl)acetamide;molecular hydrogen |
| SMILES | CCOCNC(=O)COc1ccc2c(c1)OCO2.[H][H] |
| InChI | InChI=1S/C12H15NO5.H2/c1-2-15-7-13-12(14)6-16-9-3-4-10-11(5-9)18-8-17-10;/h3-5H,2,6-8H2,1H3,(H,13,14);1H |
| InChIKey | YHEUIDWOAJSMGP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|