C16H13NO7 — CID 158353921
N,2-bis(1,3-benzodioxol-5-yloxy)acetamide (PubChem CID 158353921) has the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. Its IUPAC name is N,2-bis(1,3-benzodioxol-5-yloxy)acetamide.
| Compound Name | N,2-bis(1,3-benzodioxol-5-yloxy)acetamide |
|---|---|
| PubChem CID | 158353921 |
| Molecular Formula | C16H13NO7 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N,2-bis(1,3-benzodioxol-5-yloxy)acetamide |
| SMILES | O=C(COc1ccc2c(c1)OCO2)NOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13NO7/c18-16(7-19-10-1-3-12-14(5-10)22-8-20-12)17-24-11-2-4-13-15(6-11)23-9-21-13/h1-6H,7-9H2,(H,17,18) |
| InChIKey | TZDZZVNTSMJKGP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|