C13H15NO4 — CID 6458739
2-(1,3-benzodioxol-5-yloxy)-1-pyrrolidin-1-ylethanone (PubChem CID 6458739) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 6458739 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COc1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C13H15NO4/c15-13(14-5-1-2-6-14)8-16-10-3-4-11-12(7-10)18-9-17-11/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | HNEYKBSCAKMRCL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |