C20H20N2O5 — CID 36886354
1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-phenoxyethanone (PubChem CID 36886354) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 36886354 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H20N2O5/c23-19(13-25-16-4-2-1-3-5-16)21-8-10-22(11-9-21)20(24)15-6-7-17-18(12-15)27-14-26-17/h1-7,12H,8-11,13-14H2 |
| InChIKey | YJVPKQGWQBODPA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |