C22H24N2O5 — CID 108543540
[3-[4-(2-phenoxyacetyl)-1,4-diazepane-1-carbonyl]phenyl] acetate (PubChem CID 108543540) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [3-[4-(2-phenoxyacetyl)-1,4-diazepane-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-(2-phenoxyacetyl)-1,4-diazepane-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108543540 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [3-[4-(2-phenoxyacetyl)-1,4-diazepane-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCCN(C(=O)COc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-17(25)29-20-10-5-7-18(15-20)22(27)24-12-6-11-23(13-14-24)21(26)16-28-19-8-3-2-4-9-19/h2-5,7-10,15H,6,11-14,16H2,1H3 |
| InChIKey | BSYKXJBETAPDKO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|