C21H21BrN2O4 — CID 108926757
[3-[4-[2-(2-bromophenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108926757) has the molecular formula C21H21BrN2O4 and a molecular weight of 445.31 g/mol. Its IUPAC name is [3-[4-[2-(2-bromophenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[2-(2-bromophenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108926757 |
| Molecular Formula | C21H21BrN2O4 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | [3-[4-[2-(2-bromophenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCN(C(=O)Cc3ccccc3Br)CC2)c1 |
| InChI | InChI=1S/C21H21BrN2O4/c1-15(25)28-18-7-4-6-17(13-18)21(27)24-11-9-23(10-12-24)20(26)14-16-5-2-3-8-19(16)22/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | USIXVGKZSKNWBB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|