C22H24N2O5 — CID 108926754
[3-[4-[2-(2-methoxyphenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108926754) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [3-[4-[2-(2-methoxyphenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[2-(2-methoxyphenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108926754 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [3-[4-[2-(2-methoxyphenyl)acetyl]piperazine-1-carbonyl]phenyl] acetate |
| SMILES | COc1ccccc1CC(=O)N1CCN(C(=O)c2cccc(OC(C)=O)c2)CC1 |
| InChI | InChI=1S/C22H24N2O5/c1-16(25)29-19-8-5-7-18(14-19)22(27)24-12-10-23(11-13-24)21(26)15-17-6-3-4-9-20(17)28-2/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | FHYHQTWUCJGTAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|