C22H24N2O6 — CID 108533189
[3-[4-(3,5-dimethoxybenzoyl)piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108533189) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [3-[4-(3,5-dimethoxybenzoyl)piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-(3,5-dimethoxybenzoyl)piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108533189 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [3-[4-(3,5-dimethoxybenzoyl)piperazine-1-carbonyl]phenyl] acetate |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(=O)c3cccc(OC(C)=O)c3)CC2)c1 |
| InChI | InChI=1S/C22H24N2O6/c1-15(25)30-18-6-4-5-16(11-18)21(26)23-7-9-24(10-8-23)22(27)17-12-19(28-2)14-20(13-17)29-3/h4-6,11-14H,7-10H2,1-3H3 |
| InChIKey | FGJGPWUCAHGERQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|