C20H22N2O5 — CID 110365696
phenyl 4-(3,5-dimethoxybenzoyl)piperazine-1-carboxylate (PubChem CID 110365696) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is phenyl 4-(3,5-dimethoxybenzoyl)piperazine-1-carboxylate.
| Compound Name | phenyl 4-(3,5-dimethoxybenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110365696 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | phenyl 4-(3,5-dimethoxybenzoyl)piperazine-1-carboxylate |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(=O)Oc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-25-17-12-15(13-18(14-17)26-2)19(23)21-8-10-22(11-9-21)20(24)27-16-6-4-3-5-7-16/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | DBBWOCXGZGJTLK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |