C24H28N2O6 — CID 108927052
[3-[4-[[(3,5-dimethoxybenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108927052) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [3-[4-[[(3,5-dimethoxybenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[[(3,5-dimethoxybenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927052 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [3-[4-[[(3,5-dimethoxybenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | COc1cc(OC)cc(C(=O)NCC2CCN(C(=O)c3cccc(OC(C)=O)c3)CC2)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-16(27)32-20-6-4-5-18(11-20)24(29)26-9-7-17(8-10-26)15-25-23(28)19-12-21(30-2)14-22(13-19)31-3/h4-6,11-14,17H,7-10,15H2,1-3H3,(H,25,28) |
| InChIKey | XXDJAFVMWYTXGX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|