C26H32N2O4 — CID 108927152
[3-[4-[[(4-tert-butylbenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108927152) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is [3-[4-[[(4-tert-butylbenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[[(4-tert-butylbenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927152 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [3-[4-[[(4-tert-butylbenzoyl)amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(CNC(=O)c3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C26H32N2O4/c1-18(29)32-23-7-5-6-21(16-23)25(31)28-14-12-19(13-15-28)17-27-24(30)20-8-10-22(11-9-20)26(2,3)4/h5-11,16,19H,12-15,17H2,1-4H3,(H,27,30) |
| InChIKey | ZHBHLDCMACDYEH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|