C27H29N3O6 — CID 108927073
[3-[[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]methylcarbamoyl]phenyl] acetate (PubChem CID 108927073) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is [3-[[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927073 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | [3-[[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCC2CCN(C(=O)c3ccc4c(c3)C(=O)N(C(C)C)C4=O)CC2)c1 |
| InChI | InChI=1S/C27H29N3O6/c1-16(2)30-26(34)22-8-7-20(14-23(22)27(30)35)25(33)29-11-9-18(10-12-29)15-28-24(32)19-5-4-6-21(13-19)36-17(3)31/h4-8,13-14,16,18H,9-12,15H2,1-3H3,(H,28,32) |
| InChIKey | SRKKTLYALXGYQJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|