C24H29N3O4 — CID 108927242
[3-[4-[[[4-(dimethylamino)benzoyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108927242) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [3-[4-[[[4-(dimethylamino)benzoyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[[[4-(dimethylamino)benzoyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927242 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [3-[4-[[[4-(dimethylamino)benzoyl]amino]methyl]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(CNC(=O)c3ccc(N(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O4/c1-17(28)31-22-6-4-5-20(15-22)24(30)27-13-11-18(12-14-27)16-25-23(29)19-7-9-21(10-8-19)26(2)3/h4-10,15,18H,11-14,16H2,1-3H3,(H,25,29) |
| InChIKey | NGAXAGYHKFCXFX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|