C21H25N3O4 — CID 108924591
N-[[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methyl]pyridine-3-carboxamide (PubChem CID 108924591) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108924591 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]methyl]pyridine-3-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(CNC(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-18-10-17(11-19(12-18)28-2)21(26)24-8-5-15(6-9-24)13-23-20(25)16-4-3-7-22-14-16/h3-4,7,10-12,14-15H,5-6,8-9,13H2,1-2H3,(H,23,25) |
| InChIKey | UCIVHUINMUJJPC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |