C22H25N3O3 — CID 108924817
(E)-3-(3-methoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide (PubChem CID 108924817) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108924817 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCC2CCN(C(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-28-20-6-2-4-17(14-20)7-8-21(26)24-15-18-9-12-25(13-10-18)22(27)19-5-3-11-23-16-19/h2-8,11,14,16,18H,9-10,12-13,15H2,1H3,(H,24,26)/b8-7+ |
| InChIKey | QXDVZKQFLPXRJT-BQYQJAHWSA-N |
| XLogP | 2.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|