C21H22BrN3O2 — CID 108924833
(E)-3-(4-bromophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide (PubChem CID 108924833) has the molecular formula C21H22BrN3O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108924833 |
| Molecular Formula | C21H22BrN3O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NCC1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H22BrN3O2/c22-19-6-3-16(4-7-19)5-8-20(26)24-14-17-9-12-25(13-10-17)21(27)18-2-1-11-23-15-18/h1-8,11,15,17H,9-10,12-14H2,(H,24,26)/b8-5+ |
| InChIKey | IZTHYJKMAHDUEQ-VMPITWQZSA-N |
| XLogP | 3.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|